C22H22N2O6 — CID 4655580
2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid (PubChem CID 4655580) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid.
| Compound Name | 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid |
|---|---|
| PubChem CID | 4655580 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenoxy]acetic acid |
| SMILES | C=CCc1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C22H22N2O6/c1-3-4-15-7-12(8-16(29-2)20(15)30-11-17(25)26)10-23-24-21(27)18-13-5-6-14(9-13)19(18)22(24)28/h3,5-8,10,13-14,18-19H,1,4,9,11H2,2H3,(H,25,26) |
| InChIKey | VGPJYRKPRBTNKK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|