C29H29N3O5 — CID 3600505
2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-ethoxy-6-prop-2-enylphenoxy]-N-phenylacetamide (PubChem CID 3600505) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-ethoxy-6-prop-2-enylphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-ethoxy-6-prop-2-enylphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 3600505 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-ethoxy-6-prop-2-enylphenoxy]-N-phenylacetamide |
| SMILES | C=CCc1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc(OCC)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H29N3O5/c1-3-8-21-13-18(16-30-32-28(34)25-19-11-12-20(15-19)26(25)29(32)35)14-23(36-4-2)27(21)37-17-24(33)31-22-9-6-5-7-10-22/h3,5-7,9-14,16,19-20,25-26H,1,4,8,15,17H2,2H3,(H,31,33) |
| InChIKey | WTSFNLHSENKTOO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|