C26H24N4O7 — CID 126410503
2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide (PubChem CID 126410503) has the molecular formula C26H24N4O7 and a molecular weight of 504.50 g/mol. Its IUPAC name is 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126410503 |
| Molecular Formula | C26H24N4O7 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc([N+](=O)[O-])c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H24N4O7/c1-2-36-20-11-15(13-27-29-25(32)22-16-8-9-17(12-16)23(22)26(29)33)10-19(30(34)35)24(20)37-14-21(31)28-18-6-4-3-5-7-18/h3-11,13,16-17,22-23H,2,12,14H2,1H3,(H,28,31)/t16-,17-,22-,23+/m0/s1 |
| InChIKey | JKCLUZJLHGZPDN-BSWISCRUSA-N |
| XLogP | 3.15 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|