C25H21Br2N3O6 — CID 126409477
(1R,2R,6S,7R)-4-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126409477) has the molecular formula C25H21Br2N3O6 and a molecular weight of 619.27 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126409477 |
| Molecular Formula | C25H21Br2N3O6 |
| Molecular Weight | 619.27 g/mol |
| Exact Mass | 616.98 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCOc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc([N+](=O)[O-])c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C25H21Br2N3O6/c1-2-35-20-8-13(11-28-29-24(31)21-14-3-4-15(9-14)22(21)25(29)32)7-19(30(33)34)23(20)36-12-16-5-6-17(26)10-18(16)27/h3-8,10-11,14-15,21-22H,2,9,12H2,1H3/t14-,15-,21-,22+/m0/s1 |
| InChIKey | FYBKPZXKYCGQIN-YKTUVVHCSA-N |
| XLogP | 5.24 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|