C25H21N3O8 — CID 126412498
4-[[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126412498) has the molecular formula C25H21N3O8 and a molecular weight of 491.46 g/mol. Its IUPAC name is 4-[[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126412498 |
| Molecular Formula | C25H21N3O8 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 4-[[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc([N+](=O)[O-])c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H21N3O8/c1-35-19-9-14(11-26-27-23(29)20-16-6-7-17(10-16)21(20)24(27)30)8-18(28(33)34)22(19)36-12-13-2-4-15(5-3-13)25(31)32/h2-9,11,16-17,20-21H,10,12H2,1H3,(H,31,32)/t16-,17-,20-,21+/m0/s1 |
| InChIKey | PGPWGTDMEAXNRP-IDPBPBMLSA-N |
| XLogP | 3.02 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|