C24H18ClN3O7 — CID 5042114
3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 5042114) has the molecular formula C24H18ClN3O7 and a molecular weight of 495.88 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 5042114 |
| Molecular Formula | C24H18ClN3O7 |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(Cl)cc(C=NN3C(=O)C4C5C=CC(C5)C4C3=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18ClN3O7/c25-17-7-13(10-26-27-22(29)19-14-4-5-15(9-14)20(19)23(27)30)8-18(28(33)34)21(17)35-11-12-2-1-3-16(6-12)24(31)32/h1-8,10,14-15,19-20H,9,11H2,(H,31,32) |
| InChIKey | SUSFPRFBMJINOW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|