C24H18I2N2O5 — CID 126411780
3-[[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126411780) has the molecular formula C24H18I2N2O5 and a molecular weight of 668.23 g/mol. Its IUPAC name is 3-[[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126411780 |
| Molecular Formula | C24H18I2N2O5 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 667.93 |
| IUPAC Name | 3-[[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(I)cc(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2I)c1 |
| InChI | InChI=1S/C24H18I2N2O5/c25-17-7-13(8-18(26)21(17)33-11-12-2-1-3-16(6-12)24(31)32)10-27-28-22(29)19-14-4-5-15(9-14)20(19)23(28)30/h1-8,10,14-15,19-20H,9,11H2,(H,31,32)/t14-,15-,19-,20+/m0/s1 |
| InChIKey | TYORFPFNKQHRGL-HZVDNRATSA-N |
| XLogP | 4.31 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|