C26H23ClN2O6 — CID 4268743
3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 4268743) has the molecular formula C26H23ClN2O6 and a molecular weight of 494.93 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4268743 |
| Molecular Formula | C26H23ClN2O6 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 3-[[2-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H23ClN2O6/c1-2-34-20-10-15(9-19(27)23(20)35-13-14-4-3-5-18(8-14)26(32)33)12-28-29-24(30)21-16-6-7-17(11-16)22(21)25(29)31/h3-10,12,16-17,21-22H,2,11,13H2,1H3,(H,32,33) |
| InChIKey | ZCMGJALRXPMDMH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|