C24H19N3O7 — CID 4238560
3-[[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]methyl]benzoic acid (PubChem CID 4238560) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is 3-[[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4238560 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-[[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(C=NN3C(=O)C4C5C=CC(C5)C4C3=O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19N3O7/c28-22-20-15-5-6-16(10-15)21(20)23(29)26(22)25-11-13-4-7-19(18(9-13)27(32)33)34-12-14-2-1-3-17(8-14)24(30)31/h1-9,11,15-16,20-21H,10,12H2,(H,30,31) |
| InChIKey | FZAPCUDNZCKLJW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|