C24H18BrN3O7 — CID 126414362
3-[[4-bromo-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126414362) has the molecular formula C24H18BrN3O7 and a molecular weight of 540.33 g/mol. Its IUPAC name is 3-[[4-bromo-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-bromo-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126414362 |
| Molecular Formula | C24H18BrN3O7 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | 3-[[4-bromo-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc(Br)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18BrN3O7/c25-17-8-16(10-26-27-22(29)19-13-4-5-14(7-13)20(19)23(27)30)21(18(9-17)28(33)34)35-11-12-2-1-3-15(6-12)24(31)32/h1-6,8-10,13-14,19-20H,7,11H2,(H,31,32)/t13-,14-,19-,20+/m0/s1 |
| InChIKey | YFBZEOAHBSEDLZ-WZBLMQSHSA-N |
| XLogP | 3.78 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|