C23H17BrN4O7 — CID 126408508
(1R,2S,6R,7R)-4-[[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126408508) has the molecular formula C23H17BrN4O7 and a molecular weight of 541.31 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126408508 |
| Molecular Formula | C23H17BrN4O7 |
| Molecular Weight | 541.31 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | (1R,2S,6R,7R)-4-[[5-bromo-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1cccc([N+](=O)[O-])c1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H17BrN4O7/c24-16-8-15(10-25-26-22(29)19-13-4-5-14(7-13)20(19)23(26)30)21(18(9-16)28(33)34)35-11-12-2-1-3-17(6-12)27(31)32/h1-6,8-10,13-14,19-20H,7,11H2/t13-,14-,19-,20+/m0/s1 |
| InChIKey | BMVMKZQOQCUKMH-WZBLMQSHSA-N |
| XLogP | 3.99 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|