C24H19N3O7 — CID 126412450
(1R,2S,6R,7R)-4-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126412450) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126412450 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (1R,2S,6R,7R)-4-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N=Cc1cccc([N+](=O)[O-])c1OCc1ccc3c(c1)OCO3)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C24H19N3O7/c28-23-20-14-5-6-15(9-14)21(20)24(29)26(23)25-10-16-2-1-3-17(27(30)31)22(16)32-11-13-4-7-18-19(8-13)34-12-33-18/h1-8,10,14-15,20-21H,9,11-12H2/t14-,15-,20-,21+/m0/s1 |
| InChIKey | OVRDXIBZVCGSIZ-LATRNWQMSA-N |
| XLogP | 3.04 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|