C26H22BrClN2O6 — CID 126413261
(1R,2R,6S,7R)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-3-chloro-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126413261) has the molecular formula C26H22BrClN2O6 and a molecular weight of 573.83 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-3-chloro-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-3-chloro-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126413261 |
| Molecular Formula | C26H22BrClN2O6 |
| Molecular Weight | 573.83 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-3-chloro-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCOc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c(Cl)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H22BrClN2O6/c1-2-33-19-9-16(10-29-30-25(31)20-14-4-5-15(8-14)21(20)26(30)32)22(27)23(28)24(19)34-11-13-3-6-17-18(7-13)36-12-35-17/h3-7,9-10,14-15,20-21H,2,8,11-12H2,1H3/t14-,15-,20-,21+/m0/s1 |
| InChIKey | SBGQEAQHRLXDBT-LATRNWQMSA-N |
| XLogP | 4.95 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|