C23H24Br2N2O6 — CID 126408154
ethyl (2S)-2-[2,3-dibromo-4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]propanoate (PubChem CID 126408154) has the molecular formula C23H24Br2N2O6 and a molecular weight of 584.26 g/mol. Its IUPAC name is ethyl (2S)-2-[2,3-dibromo-4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[2,3-dibromo-4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126408154 |
| Molecular Formula | C23H24Br2N2O6 |
| Molecular Weight | 584.26 g/mol |
| Exact Mass | 582.00 |
| IUPAC Name | ethyl (2S)-2-[2,3-dibromo-4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(OCC)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c1Br |
| InChI | InChI=1S/C23H24Br2N2O6/c1-4-31-15-9-14(18(24)19(25)20(15)33-11(3)23(30)32-5-2)10-26-27-21(28)16-12-6-7-13(8-12)17(16)22(27)29/h6-7,9-13,16-17H,4-5,8H2,1-3H3/t11-,12-,13-,16-,17+/m0/s1 |
| InChIKey | AOBVPCHOCBTJED-UCQBOQSVSA-N |
| XLogP | 4.08 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|