C21H20BrClN2O6 — CID 126408924
ethyl 2-[3-bromo-2-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate (PubChem CID 126408924) has the molecular formula C21H20BrClN2O6 and a molecular weight of 511.76 g/mol. Its IUPAC name is ethyl 2-[3-bromo-2-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[3-bromo-2-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126408924 |
| Molecular Formula | C21H20BrClN2O6 |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | ethyl 2-[3-bromo-2-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(OC)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c1Cl |
| InChI | InChI=1S/C21H20BrClN2O6/c1-3-30-14(26)9-31-19-13(29-2)7-12(17(22)18(19)23)8-24-25-20(27)15-10-4-5-11(6-10)16(15)21(25)28/h4-5,7-8,10-11,15-16H,3,6,9H2,1-2H3/t10-,11-,15-,16+/m0/s1 |
| InChIKey | CWTBTROVTKKVGA-KUDNYVPYSA-N |
| XLogP | 3.19 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|