C26H23Br2N3O5 — CID 126414502
2-[2,3-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126414502) has the molecular formula C26H23Br2N3O5 and a molecular weight of 617.29 g/mol. Its IUPAC name is 2-[2,3-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,3-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126414502 |
| Molecular Formula | C26H23Br2N3O5 |
| Molecular Weight | 617.29 g/mol |
| Exact Mass | 615.00 |
| IUPAC Name | 2-[2,3-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c(Br)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H23Br2N3O5/c1-13-5-3-4-6-17(13)30-19(32)12-36-24-18(35-2)10-16(22(27)23(24)28)11-29-31-25(33)20-14-7-8-15(9-14)21(20)26(31)34/h3-8,10-11,14-15,20-21H,9,12H2,1-2H3,(H,30,32)/t14-,15-,20-,21+/m0/s1 |
| InChIKey | ZQZVQLFDZJJFQA-LATRNWQMSA-N |
| XLogP | 4.69 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|