C24H20FN3O4 — CID 126405728
2-[2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126405728) has the molecular formula C24H20FN3O4 and a molecular weight of 433.44 g/mol. Its IUPAC name is 2-[2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126405728 |
| Molecular Formula | C24H20FN3O4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccccc1C=NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)Nc1ccccc1F |
| InChI | InChI=1S/C24H20FN3O4/c25-17-6-2-3-7-18(17)27-20(29)13-32-19-8-4-1-5-16(19)12-26-28-23(30)21-14-9-10-15(11-14)22(21)24(28)31/h1-10,12,14-15,21-22H,11,13H2,(H,27,29)/t14-,15-,21-,22+/m0/s1 |
| InChIKey | ANPVWJUUUZOVTO-YKTUVVHCSA-N |
| XLogP | 2.98 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|