C24H19FN4O6 — CID 3669218
2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 3669218) has the molecular formula C24H19FN4O6 and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3669218 |
| Molecular Formula | C24H19FN4O6 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1C=NN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H19FN4O6/c25-17-3-1-2-4-18(17)27-20(30)12-35-19-8-7-16(29(33)34)10-15(19)11-26-28-23(31)21-13-5-6-14(9-13)22(21)24(28)32/h1-8,10-11,13-14,21-22H,9,12H2,(H,27,30) |
| InChIKey | UYVXGUOSTYVTNU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|