C21H21N3O7 — CID 4665999
ethyl 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]propanoate (PubChem CID 4665999) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is ethyl 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]propanoate.
| Compound Name | ethyl 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 4665999 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | ethyl 2-[2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-4-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc([N+](=O)[O-])cc1C=NN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H21N3O7/c1-3-30-21(27)11(2)31-16-7-6-15(24(28)29)9-14(16)10-22-23-19(25)17-12-4-5-13(8-12)18(17)20(23)26/h4-7,9-13,17-18H,3,8H2,1-2H3 |
| InChIKey | ABLJJCGFPFHISJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|