C21H21ClN2O5 — CID 4643631
ethyl 2-[4-chloro-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoate (PubChem CID 4643631) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is ethyl 2-[4-chloro-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[4-chloro-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 4643631 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | ethyl 2-[4-chloro-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc(Cl)cc1C=NN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H21ClN2O5/c1-3-28-21(27)11(2)29-16-7-6-15(22)9-14(16)10-23-24-19(25)17-12-4-5-13(8-12)18(17)20(24)26/h4-7,9-13,17-18H,3,8H2,1-2H3 |
| InChIKey | SHSGXZQOLJXQFD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|