C21H20Br2N2O5 — CID 126407284
ethyl (2S)-2-[2,6-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate (PubChem CID 126407284) has the molecular formula C21H20Br2N2O5 and a molecular weight of 540.21 g/mol. Its IUPAC name is ethyl (2S)-2-[2,6-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[2,6-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126407284 |
| Molecular Formula | C21H20Br2N2O5 |
| Molecular Weight | 540.21 g/mol |
| Exact Mass | 537.97 |
| IUPAC Name | ethyl (2S)-2-[2,6-dibromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(Br)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1Br |
| InChI | InChI=1S/C21H20Br2N2O5/c1-3-29-21(28)10(2)30-18-14(22)6-11(7-15(18)23)9-24-25-19(26)16-12-4-5-13(8-12)17(16)20(25)27/h4-7,9-10,12-13,16-17H,3,8H2,1-2H3/t10-,12-,13-,16-,17+/m0/s1 |
| InChIKey | GCNWQIHIVWJQNX-KMNSEVKQSA-N |
| XLogP | 3.68 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|