C20H18BrClN2O5 — CID 126408202
methyl (2S)-2-[2-bromo-4-chloro-6-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate (PubChem CID 126408202) has the molecular formula C20H18BrClN2O5 and a molecular weight of 481.73 g/mol. Its IUPAC name is methyl (2S)-2-[2-bromo-4-chloro-6-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate.
| Compound Name | methyl (2S)-2-[2-bromo-4-chloro-6-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126408202 |
| Molecular Formula | C20H18BrClN2O5 |
| Molecular Weight | 481.73 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | methyl (2S)-2-[2-bromo-4-chloro-6-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1c(Br)cc(Cl)cc1C=NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H18BrClN2O5/c1-9(20(27)28-2)29-17-12(6-13(22)7-14(17)21)8-23-24-18(25)15-10-3-4-11(5-10)16(15)19(24)26/h3-4,6-11,15-16H,5H2,1-2H3/t9-,10-,11-,15-,16+/m0/s1 |
| InChIKey | AXTSJMGIUFQLEL-WQFFQYHTSA-N |
| XLogP | 3.18 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|