C17H14BrClN2O3 — CID 5025328
4-[(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 5025328) has the molecular formula C17H14BrClN2O3 and a molecular weight of 409.67 g/mol. Its IUPAC name is 4-[(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 5025328 |
| Molecular Formula | C17H14BrClN2O3 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 4-[(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1c(Cl)cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1Br |
| InChI | InChI=1S/C17H14BrClN2O3/c1-24-15-11(18)4-8(5-12(15)19)7-20-21-16(22)13-9-2-3-10(6-9)14(13)17(21)23/h2-5,7,9-10,13-14H,6H2,1H3 |
| InChIKey | FPJQKUOAWIHOQA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|