C20H18BrClN2O5 — CID 126409638
ethyl 2-[2-bromo-6-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]acetate (PubChem CID 126409638) has the molecular formula C20H18BrClN2O5 and a molecular weight of 481.73 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126409638 |
| Molecular Formula | C20H18BrClN2O5 |
| Molecular Weight | 481.73 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | ethyl 2-[2-bromo-6-chloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1Br |
| InChI | InChI=1S/C20H18BrClN2O5/c1-2-28-15(25)9-29-18-13(21)5-10(6-14(18)22)8-23-24-19(26)16-11-3-4-12(7-11)17(16)20(24)27/h3-6,8,11-12,16-17H,2,7,9H2,1H3/t11-,12-,16-,17+/m0/s1 |
| InChIKey | NEYGZIPYDAOOEQ-MWDDYTRKSA-N |
| XLogP | 3.19 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.73 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|