C18H15BrClN3O4 — CID 3283815
2-[2-bromo-6-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide (PubChem CID 3283815) has the molecular formula C18H15BrClN3O4 and a molecular weight of 452.69 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide.
| Compound Name | 2-[2-bromo-6-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3283815 |
| Molecular Formula | C18H15BrClN3O4 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1c(Cl)cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1Br |
| InChI | InChI=1S/C18H15BrClN3O4/c19-11-3-8(4-12(20)16(11)27-7-13(21)24)6-22-23-17(25)14-9-1-2-10(5-9)15(14)18(23)26/h1-4,6,9-10,14-15H,5,7H2,(H2,21,24) |
| InChIKey | ICWQVFXCMAUXHI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|