C21H20ClN3O7 — CID 126409958
ethyl (2R)-2-[4-chloro-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]propanoate (PubChem CID 126409958) has the molecular formula C21H20ClN3O7 and a molecular weight of 461.86 g/mol. Its IUPAC name is ethyl (2R)-2-[4-chloro-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-chloro-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126409958 |
| Molecular Formula | C21H20ClN3O7 |
| Molecular Weight | 461.86 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | ethyl (2R)-2-[4-chloro-2-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20ClN3O7/c1-3-31-21(28)10(2)32-18-13(7-14(22)8-15(18)25(29)30)9-23-24-19(26)16-11-4-5-12(6-11)17(16)20(24)27/h4-5,7-12,16-17H,3,6H2,1-2H3/t10-,11+,12+,16-,17+/m1/s1 |
| InChIKey | HNACYYIQKNEIKZ-XJSUSFSXSA-N |
| XLogP | 2.72 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|