C19H17ClN2O5 — CID 126409422
(2R)-2-[4-chloro-2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoic acid (PubChem CID 126409422) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is (2R)-2-[4-chloro-2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-chloro-2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126409422 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2R)-2-[4-chloro-2-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1C=NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)C(=O)O |
| InChI | InChI=1S/C19H17ClN2O5/c1-9(19(25)26)27-14-5-4-13(20)7-12(14)8-21-22-17(23)15-10-2-3-11(6-10)16(15)18(22)24/h2-5,7-11,15-16H,6H2,1H3,(H,25,26)/t9-,10+,11+,15-,16+/m1/s1 |
| InChIKey | FNFZKQZHPOOCGB-OWWRBYITSA-N |
| XLogP | 2.33 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|