C23H18FN3O5 — CID 126414269
(1R,2R,6S,7R)-4-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126414269) has the molecular formula C23H18FN3O5 and a molecular weight of 435.41 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126414269 |
| Molecular Formula | C23H18FN3O5 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[2-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N=Cc1cc([N+](=O)[O-])ccc1OCc1ccccc1F)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H18FN3O5/c24-18-4-2-1-3-15(18)12-32-19-8-7-17(27(30)31)10-16(19)11-25-26-22(28)20-13-5-6-14(9-13)21(20)23(26)29/h1-8,10-11,13-14,20-21H,9,12H2/t13-,14-,20-,21+/m0/s1 |
| InChIKey | XUTFWJGEIWNSKM-MFRYECHYSA-N |
| XLogP | 3.45 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|