C23H17FI2N2O3 — CID 126408740
(1R,2S,6R,7R)-4-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126408740) has the molecular formula C23H17FI2N2O3 and a molecular weight of 642.21 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126408740 |
| Molecular Formula | C23H17FI2N2O3 |
| Molecular Weight | 642.21 g/mol |
| Exact Mass | 641.93 |
| IUPAC Name | (1R,2S,6R,7R)-4-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N=Cc1cc(I)c(OCc3ccccc3F)c(I)c1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H17FI2N2O3/c24-16-4-2-1-3-15(16)11-31-21-17(25)7-12(8-18(21)26)10-27-28-22(29)19-13-5-6-14(9-13)20(19)23(28)30/h1-8,10,13-14,19-20H,9,11H2/t13-,14-,19-,20+/m0/s1 |
| InChIKey | KGGAJJNMZXCULA-WZBLMQSHSA-N |
| XLogP | 4.75 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|