C16H11FI2N4O — CID 91970257
1-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 91970257) has the molecular formula C16H11FI2N4O and a molecular weight of 548.10 g/mol. Its IUPAC name is 1-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 91970257 |
| Molecular Formula | C16H11FI2N4O |
| Molecular Weight | 548.10 g/mol |
| Exact Mass | 547.90 |
| IUPAC Name | 1-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Fc1ccccc1COc1c(I)cc(C=Nn2cnnc2)cc1I |
| InChI | InChI=1S/C16H11FI2N4O/c17-13-4-2-1-3-12(13)8-24-16-14(18)5-11(6-15(16)19)7-22-23-9-20-21-10-23/h1-7,9-10H,8H2 |
| InChIKey | QEVYFPIGXUNTBR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|