C20H15FI2N2O3S — CID 124601500
5-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124601500) has the molecular formula C20H15FI2N2O3S and a molecular weight of 636.22 g/mol. Its IUPAC name is 5-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124601500 |
| Molecular Formula | C20H15FI2N2O3S |
| Molecular Weight | 636.22 g/mol |
| Exact Mass | 635.89 |
| IUPAC Name | 5-[[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=Cc2cc(I)c(OCc3ccccc3F)c(I)c2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C20H15FI2N2O3S/c1-24-18(26)13(19(27)25(2)20(24)29)7-11-8-15(22)17(16(23)9-11)28-10-12-5-3-4-6-14(12)21/h3-9H,10H2,1-2H3 |
| InChIKey | VAUJDRDTWGXNAR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|