C21H14FI2N3OS — CID 126085487
N-[(E)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 126085487) has the molecular formula C21H14FI2N3OS and a molecular weight of 629.24 g/mol. Its IUPAC name is N-[(E)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 126085487 |
| Molecular Formula | C21H14FI2N3OS |
| Molecular Weight | 629.24 g/mol |
| Exact Mass | 628.89 |
| IUPAC Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccccc1COc1c(I)cc(/C=N/Nc2nc3ccccc3s2)cc1I |
| InChI | InChI=1S/C21H14FI2N3OS/c22-15-6-2-1-5-14(15)12-28-20-16(23)9-13(10-17(20)24)11-25-27-21-26-18-7-3-4-8-19(18)29-21/h1-11H,12H2,(H,26,27)/b25-11+ |
| InChIKey | KIDRWEHQYDUTHR-OPEKNORGSA-N |
| XLogP | 6.67 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.24 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|