C19H13FI2N4O3 — CID 126080640
N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126080640) has the molecular formula C19H13FI2N4O3 and a molecular weight of 618.14 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126080640 |
| Molecular Formula | C19H13FI2N4O3 |
| Molecular Weight | 618.14 g/mol |
| Exact Mass | 617.91 |
| IUPAC Name | N-[(Z)-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1N/N=C\c1cc(I)c(OCc2ccccc2F)c(I)c1 |
| InChI | InChI=1S/C19H13FI2N4O3/c20-14-5-2-1-4-13(14)11-29-18-15(21)8-12(9-16(18)22)10-24-25-19-17(26(27)28)6-3-7-23-19/h1-10H,11H2,(H,23,25)/b24-10- |
| InChIKey | PPIMNIAFEQGWNQ-VROXFSQNSA-N |
| XLogP | 5.36 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.14 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|