C15H10Cl2N4O3 — CID 126071392
N-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126071392) has the molecular formula C15H10Cl2N4O3 and a molecular weight of 365.18 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126071392 |
| Molecular Formula | C15H10Cl2N4O3 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-4-prop-2-ynoxyphenyl)methylideneamino]-3-nitropyridin-2-amine |
| SMILES | C#CCOc1c(Cl)cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H10Cl2N4O3/c1-2-6-24-14-11(16)7-10(8-12(14)17)9-19-20-15-13(21(22)23)4-3-5-18-15/h1,3-5,7-9H,6H2,(H,18,20)/b19-9- |
| InChIKey | KEKAZBDMWUTIMS-OCKHKDLRSA-N |
| XLogP | 3.75 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|