C13H9F3N4O2 — CID 2740940
3-nitro-N-[[3-(trifluoromethyl)phenyl]methylideneamino]pyridin-2-amine (PubChem CID 2740940) has the molecular formula C13H9F3N4O2 and a molecular weight of 310.24 g/mol. Its IUPAC name is 3-nitro-N-[[3-(trifluoromethyl)phenyl]methylideneamino]pyridin-2-amine.
| Compound Name | 3-nitro-N-[[3-(trifluoromethyl)phenyl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 2740940 |
| Molecular Formula | C13H9F3N4O2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-nitro-N-[[3-(trifluoromethyl)phenyl]methylideneamino]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NN=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3N4O2/c14-13(15,16)10-4-1-3-9(7-10)8-18-19-12-11(20(21)22)5-2-6-17-12/h1-8H,(H,17,19) |
| InChIKey | ZYIIVTOZBTVTST-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|