C20H17FN4O4 — CID 126095785
N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126095785) has the molecular formula C20H17FN4O4 and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126095785 |
| Molecular Formula | C20H17FN4O4 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | COc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN4O4/c1-28-19-11-15(12-23-24-20-17(25(26)27)3-2-10-22-20)6-9-18(19)29-13-14-4-7-16(21)8-5-14/h2-12H,13H2,1H3,(H,22,24)/b23-12- |
| InChIKey | NPQWUENSERHBFI-FMCGGJTJSA-N |
| XLogP | 4.16 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|