C21H18BrFN4O4 — CID 126113281
N-[(Z)-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126113281) has the molecular formula C21H18BrFN4O4 and a molecular weight of 489.30 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126113281 |
| Molecular Formula | C21H18BrFN4O4 |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | N-[(Z)-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18BrFN4O4/c1-2-30-19-10-15(12-25-26-21-18(27(28)29)4-3-9-24-21)17(22)11-20(19)31-13-14-5-7-16(23)8-6-14/h3-12H,2,13H2,1H3,(H,24,26)/b25-12- |
| InChIKey | NNXSOBOKHVLIHL-ROTLSHHCSA-N |
| XLogP | 5.32 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|