C21H18BrN5O6 — CID 126081092
N-[(Z)-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126081092) has the molecular formula C21H18BrN5O6 and a molecular weight of 516.31 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126081092 |
| Molecular Formula | C21H18BrN5O6 |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | N-[(Z)-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18BrN5O6/c1-2-32-19-10-15(12-24-25-21-18(27(30)31)4-3-9-23-21)17(22)11-20(19)33-13-14-5-7-16(8-6-14)26(28)29/h3-12H,2,13H2,1H3,(H,23,25)/b24-12- |
| InChIKey | VBVGTMVQMAFSOJ-MSXFZWOLSA-N |
| XLogP | 5.08 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|