C24H23BrN4O4 — CID 126112614
N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126112614) has the molecular formula C24H23BrN4O4 and a molecular weight of 511.38 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126112614 |
| Molecular Formula | C24H23BrN4O4 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | C=CCc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc(OCC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H23BrN4O4/c1-3-6-19-13-18(15-27-28-24-21(29(30)31)7-5-12-26-24)14-22(32-4-2)23(19)33-16-17-8-10-20(25)11-9-17/h3,5,7-15H,1,4,6,16H2,2H3,(H,26,28)/b27-15- |
| InChIKey | QYPRLXJSOHSDRH-DICXZTSXSA-N |
| XLogP | 5.90 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|