C19H14BrIN4O3 — CID 126100338
N-[(Z)-[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126100338) has the molecular formula C19H14BrIN4O3 and a molecular weight of 553.15 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126100338 |
| Molecular Formula | C19H14BrIN4O3 |
| Molecular Weight | 553.15 g/mol |
| Exact Mass | 551.93 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1N/N=C\c1ccc(OCc2ccc(I)cc2)c(Br)c1 |
| InChI | InChI=1S/C19H14BrIN4O3/c20-16-10-14(11-23-24-19-17(25(26)27)2-1-9-22-19)5-8-18(16)28-12-13-3-6-15(21)7-4-13/h1-11H,12H2,(H,22,24)/b23-11- |
| InChIKey | CDDBMULOBFVPPN-KSEXSDGBSA-N |
| XLogP | 5.38 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.15 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|