C21H19ClN4O4 — CID 126075203
N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126075203) has the molecular formula C21H19ClN4O4 and a molecular weight of 426.86 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126075203 |
| Molecular Formula | C21H19ClN4O4 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN4O4/c1-2-29-20-12-16(13-24-25-21-18(26(27)28)4-3-11-23-21)7-10-19(20)30-14-15-5-8-17(22)9-6-15/h3-13H,2,14H2,1H3,(H,23,25)/b24-13- |
| InChIKey | IXIYRAGEFMNUIZ-CFRMEGHHSA-N |
| XLogP | 5.07 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|