C19H15N5O5 — CID 126109598
3-nitro-N-[(Z)-(3-nitro-4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 126109598) has the molecular formula C19H15N5O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is 3-nitro-N-[(Z)-(3-nitro-4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3-nitro-N-[(Z)-(3-nitro-4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 126109598 |
| Molecular Formula | C19H15N5O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-nitro-N-[(Z)-(3-nitro-4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(/C=N\Nc2ncccc2[N+](=O)[O-])ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H15N5O5/c25-23(26)16-7-4-10-20-19(16)22-21-12-15-8-9-18(17(11-15)24(27)28)29-13-14-5-2-1-3-6-14/h1-12H,13H2,(H,20,22)/b21-12- |
| InChIKey | GECMOVUIJSPUJX-MTJSOVHGSA-N |
| XLogP | 3.92 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|