C13H11BrN4O4 — CID 135642188
2-bromo-6-methoxy-4-[(E)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol (PubChem CID 135642188) has the molecular formula C13H11BrN4O4 and a molecular weight of 367.16 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(E)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(E)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135642188 |
| Molecular Formula | C13H11BrN4O4 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(E)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/Nc2ncccc2[N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C13H11BrN4O4/c1-22-11-6-8(5-9(14)12(11)19)7-16-17-13-10(18(20)21)3-2-4-15-13/h2-7,19H,1H3,(H,15,17)/b16-7+ |
| InChIKey | PVQPDDHTGGJUEX-FRKPEAEDSA-N |
| XLogP | 2.91 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|