C16H17IN4O4 — CID 126108928
N-[(Z)-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126108928) has the molecular formula C16H17IN4O4 and a molecular weight of 456.24 g/mol. Its IUPAC name is N-[(Z)-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126108928 |
| Molecular Formula | C16H17IN4O4 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | N-[(Z)-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-nitropyridin-2-amine |
| SMILES | COc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc(I)c1OC(C)C |
| InChI | InChI=1S/C16H17IN4O4/c1-10(2)25-15-12(17)7-11(8-14(15)24-3)9-19-20-16-13(21(22)23)5-4-6-18-16/h4-10H,1-3H3,(H,18,20)/b19-9- |
| InChIKey | DMPONSYISZYVKR-OCKHKDLRSA-N |
| XLogP | 3.84 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|