C20H15Cl3N4O4 — CID 126101173
N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126101173) has the molecular formula C20H15Cl3N4O4 and a molecular weight of 481.72 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126101173 |
| Molecular Formula | C20H15Cl3N4O4 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | COc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl3N4O4/c1-30-18-8-12(10-25-26-20-17(27(28)29)3-2-6-24-20)7-16(23)19(18)31-11-13-4-5-14(21)9-15(13)22/h2-10H,11H2,1H3,(H,24,26)/b25-10- |
| InChIKey | GJOBMMYQUFRZAV-MRUKODCESA-N |
| XLogP | 5.98 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|