C16H14Cl3N3O3 — CID 6079153
[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea (PubChem CID 6079153) has the molecular formula C16H14Cl3N3O3 and a molecular weight of 402.67 g/mol. Its IUPAC name is [(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea.
| Compound Name | [(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 6079153 |
| Molecular Formula | C16H14Cl3N3O3 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | [(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea |
| SMILES | COc1cc(/C=N\NC(N)=O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3N3O3/c1-24-14-5-9(7-21-22-16(20)23)4-13(19)15(14)25-8-10-2-3-11(17)6-12(10)18/h2-7H,8H2,1H3,(H3,20,22,23)/b21-7- |
| InChIKey | JEEQHUZRYMHONX-YXSASFKJSA-N |
| XLogP | 4.24 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|