C21H21Cl3N2O3S2 — CID 6250397
N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide (PubChem CID 6250397) has the molecular formula C21H21Cl3N2O3S2 and a molecular weight of 519.90 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide.
| Compound Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
|---|---|
| PubChem CID | 6250397 |
| Molecular Formula | C21H21Cl3N2O3S2 |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(2-methyl-1,3-dithiolan-2-yl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CC2(C)SCCS2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl3N2O3S2/c1-21(30-5-6-31-21)10-19(27)26-25-11-13-7-17(24)20(18(8-13)28-2)29-12-14-3-4-15(22)9-16(14)23/h3-4,7-9,11H,5-6,10,12H2,1-2H3,(H,26,27)/b25-11- |
| InChIKey | KBKORSWSMUTEDY-GATIEOLUSA-N |
| XLogP | 6.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|