C23H18Cl3N3O5 — CID 126064022
N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 126064022) has the molecular formula C23H18Cl3N3O5 and a molecular weight of 522.77 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126064022 |
| Molecular Formula | C23H18Cl3N3O5 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc([N+](=O)[O-])cc2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl3N3O5/c1-33-21-9-15(8-20(26)23(21)34-13-16-4-5-17(24)11-19(16)25)12-27-28-22(30)10-14-2-6-18(7-3-14)29(31)32/h2-9,11-12H,10,13H2,1H3,(H,28,30)/b27-12- |
| InChIKey | QEBYZJRBZJSQFN-PPDIBHTLSA-N |
| XLogP | 5.84 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|