C23H19Cl3N2O4 — CID 21380003
N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 21380003) has the molecular formula C23H19Cl3N2O4 and a molecular weight of 493.77 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 21380003 |
| Molecular Formula | C23H19Cl3N2O4 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)C(O)c2ccccc2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl3N2O4/c1-31-20-10-14(12-27-28-23(30)21(29)15-5-3-2-4-6-15)9-19(26)22(20)32-13-16-7-8-17(24)11-18(16)25/h2-12,21,29H,13H2,1H3,(H,28,30)/b27-12+ |
| InChIKey | XOKGQBODWSCUJV-KKMKTNMSSA-N |
| XLogP | 5.42 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|