C28H20Br2Cl2N2O2 — CID 126396544
N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 126396544) has the molecular formula C28H20Br2Cl2N2O2 and a molecular weight of 647.19 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126396544 |
| Molecular Formula | C28H20Br2Cl2N2O2 |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 643.93 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(Br)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H20Br2Cl2N2O2/c29-23-13-18(14-24(30)27(23)36-17-21-11-12-22(31)15-25(21)32)16-33-34-28(35)26(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-16,26H,17H2,(H,34,35)/b33-16+ |
| InChIKey | MPNDTHQYRYZLHW-MHDJOFBISA-N |
| XLogP | 8.38 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|